C13H18INO — CID 118889673
4-(3,4-dihydro-2H-chromen-4-yl)-1-iodobutan-1-amine (PubChem CID 118889673) has the molecular formula C13H18INO and a molecular weight of 331.20 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-4-yl)-1-iodobutan-1-amine.
| Compound Name | 4-(3,4-dihydro-2H-chromen-4-yl)-1-iodobutan-1-amine |
|---|---|
| PubChem CID | 118889673 |
| Molecular Formula | C13H18INO |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-4-yl)-1-iodobutan-1-amine |
| SMILES | NC(I)CCCC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H18INO/c14-13(15)7-3-4-10-8-9-16-12-6-2-1-5-11(10)12/h1-2,5-6,10,13H,3-4,7-9,15H2 |
| InChIKey | BVSPGBSDJFXPLE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|