C11H16ClNO — CID 175798234
2-(3,4-dihydro-2H-chromen-4-yl)ethanamine;hydrochloride (PubChem CID 175798234) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-yl)ethanamine;hydrochloride.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 175798234 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-yl)ethanamine;hydrochloride |
| SMILES | Cl.NCCC1CCOc2ccccc21 |
| InChI | InChI=1S/C11H15NO.ClH/c12-7-5-9-6-8-13-11-4-2-1-3-10(9)11;/h1-4,9H,5-8,12H2;1H |
| InChIKey | OOCXYTAOMQDFJY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |