C11H14ClNO — CID 82078156
2-(6-chloro-3,4-dihydro-2H-chromen-4-yl)ethanamine (PubChem CID 82078156) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-chromen-4-yl)ethanamine.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-chromen-4-yl)ethanamine |
|---|---|
| PubChem CID | 82078156 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-chromen-4-yl)ethanamine |
| SMILES | NCCC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H14ClNO/c12-9-1-2-11-10(7-9)8(3-5-13)4-6-14-11/h1-2,7-8H,3-6,13H2 |
| InChIKey | KWPNRVMNFTXZIJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |