C9H9ClO2 — CID 15148408
6-chloro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 15148408) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is 6-chloro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-chloro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 15148408 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 6-chloro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H9ClO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5,8,11H,3-4H2 |
| InChIKey | DTXFWMLTXBVKIG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |