C11H14O3 — CID 67687802
6-(2-hydroxyethyl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 67687802) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-(2-hydroxyethyl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 67687802 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6-(2-hydroxyethyl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OCCc1ccc2c(c1)C(O)CCO2 |
| InChI | InChI=1S/C11H14O3/c12-5-3-8-1-2-11-9(7-8)10(13)4-6-14-11/h1-2,7,10,12-13H,3-6H2 |
| InChIKey | GDHNSAUMIGZESJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |