C11H14O2 — CID 69174288
(4R)-7-ethyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 69174288) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (4R)-7-ethyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-7-ethyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 69174288 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (4R)-7-ethyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCc1ccc2c(c1)OCC[C@H]2O |
| InChI | InChI=1S/C11H14O2/c1-2-8-3-4-9-10(12)5-6-13-11(9)7-8/h3-4,7,10,12H,2,5-6H2,1H3/t10-/m1/s1 |
| InChIKey | YTRVPECLCSSNNS-SNVBAGLBSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |