C15H24O3Si — CID 129403845
(4R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-chromen-4-ol (PubChem CID 129403845) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is (4R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 129403845 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (4R)-7-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)OCC[C@H]2O |
| InChI | InChI=1S/C15H24O3Si/c1-15(2,3)19(4,5)18-11-6-7-12-13(16)8-9-17-14(12)10-11/h6-7,10,13,16H,8-9H2,1-5H3/t13-/m1/s1 |
| InChIKey | WIHLEKULPYWOQD-CYBMUJFWSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|