C15H24O2Si — CID 124636580
(1R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 124636580) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is (1R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 124636580 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc2c1CC[C@H]2O |
| InChI | InChI=1S/C15H24O2Si/c1-15(2,3)18(4,5)17-14-8-6-7-11-12(14)9-10-13(11)16/h6-8,13,16H,9-10H2,1-5H3/t13-/m1/s1 |
| InChIKey | MIOUJDQKLNIETA-CYBMUJFWSA-N |
| XLogP | 4.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|