C12H20O2Si — CID 10878826
2-[tert-butyl(dimethyl)silyl]oxyphenol (PubChem CID 10878826) has the molecular formula C12H20O2Si and a molecular weight of 224.38 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxyphenol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxyphenol |
|---|---|
| PubChem CID | 10878826 |
| Molecular Formula | C12H20O2Si |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxyphenol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccccc1O |
| InChI | InChI=1S/C12H20O2Si/c1-12(2,3)15(4,5)14-11-9-7-6-8-10(11)13/h6-9,13H,1-5H3 |
| InChIKey | LCTNVXUTAZVSEX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|