C34H64O4Si4 — CID 10604266
tert-butyl-dimethyl-[4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]naphthalen-1-yl]oxysilane (PubChem CID 10604266) has the molecular formula C34H64O4Si4 and a molecular weight of 649.23 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]naphthalen-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]naphthalen-1-yl]oxysilane |
|---|---|
| PubChem CID | 10604266 |
| Molecular Formula | C34H64O4Si4 |
| Molecular Weight | 649.23 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | tert-butyl-dimethyl-[4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]naphthalen-1-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(O[Si](C)(C)C(C)(C)C)c2c(O[Si](C)(C)C(C)(C)C)ccc(O[Si](C)(C)C(C)(C)C)c12 |
| InChI | InChI=1S/C34H64O4Si4/c1-31(2,3)39(13,14)35-25-21-22-27(37-41(17,18)33(7,8)9)30-28(38-42(19,20)34(10,11)12)24-23-26(29(25)30)36-40(15,16)32(4,5)6/h21-24H,1-20H3 |
| InChIKey | JZYMGZSBISGOEO-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.23 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|