C13H21ClO2Si — CID 125116719
tert-butyl-(5-chloro-2-methoxyphenoxy)-dimethylsilane (PubChem CID 125116719) has the molecular formula C13H21ClO2Si and a molecular weight of 272.85 g/mol. Its IUPAC name is tert-butyl-(5-chloro-2-methoxyphenoxy)-dimethylsilane.
| Compound Name | tert-butyl-(5-chloro-2-methoxyphenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 125116719 |
| Molecular Formula | C13H21ClO2Si |
| Molecular Weight | 272.85 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | tert-butyl-(5-chloro-2-methoxyphenoxy)-dimethylsilane |
| SMILES | COc1ccc(Cl)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H21ClO2Si/c1-13(2,3)17(5,6)16-12-9-10(14)7-8-11(12)15-4/h7-9H,1-6H3 |
| InChIKey | XTUQTNFXMMRQOD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|