C19H37NO2Si2 — CID 91741360
N-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline (PubChem CID 91741360) has the molecular formula C19H37NO2Si2 and a molecular weight of 367.68 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline |
|---|---|
| PubChem CID | 91741360 |
| Molecular Formula | C19H37NO2Si2 |
| Molecular Weight | 367.68 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxyaniline |
| SMILES | COc1ccc(N[Si](C)(C)C(C)(C)C)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37NO2Si2/c1-18(2,3)23(8,9)20-15-12-13-16(21-7)17(14-15)22-24(10,11)19(4,5)6/h12-14,20H,1-11H3 |
| InChIKey | FDGVNDZSHWYHME-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|