C15H26O4Si — CID 102281484
tert-butyl-dimethyl-(2,4,6-trimethoxyphenoxy)silane (PubChem CID 102281484) has the molecular formula C15H26O4Si and a molecular weight of 298.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,4,6-trimethoxyphenoxy)silane.
| Compound Name | tert-butyl-dimethyl-(2,4,6-trimethoxyphenoxy)silane |
|---|---|
| PubChem CID | 102281484 |
| Molecular Formula | C15H26O4Si |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | tert-butyl-dimethyl-(2,4,6-trimethoxyphenoxy)silane |
| SMILES | COc1cc(OC)c(O[Si](C)(C)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H26O4Si/c1-15(2,3)20(7,8)19-14-12(17-5)9-11(16-4)10-13(14)18-6/h9-10H,1-8H3 |
| InChIKey | ZSOBFXYPLPSKCV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|