About tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane
tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane (PubChem CID 11449702) has the molecular formula C17H28O3Si
and a molecular weight of 308.49 g/mol. Its IUPAC name is tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane |
| PubChem CID | 11449702 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane |
| SMILES | C=CCc1c(OC)cc(OC)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28O3Si/c1-9-10-14-15(19-6)11-13(18-5)12-16(14)20-21(7,8)17(2,3)4/h9,11-12H,1,10H2,2-8H3 |
| InChIKey | QKZVJYLOIMVSFU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane?
The IUPAC name of tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane (CID 11449702) is tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane.
What is the SMILES notation for tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane?
The canonical SMILES for tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane is C=CCc1c(OC)cc(OC)cc1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane?
The InChIKey is QKZVJYLOIMVSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3Si/c1-9-10-14-15(19-6)11-13(18-5)12-16(14)20-21(7,8)17(2,3)4/h9,11-12H,1,10H2,2-8H3.
What are the key properties of tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane?
tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane has a molecular weight of 308.49 g/mol, XLogP of 4.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(3,5-dimethoxy-2-prop-2-enylphenoxy)-dimethylsilane is sourced from PubChem (CID 11449702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).