C11H12Br2O2 — CID 46910681
2,4-dibromo-1,5-dimethoxy-3-prop-2-enylbenzene (PubChem CID 46910681) has the molecular formula C11H12Br2O2 and a molecular weight of 336.02 g/mol. Its IUPAC name is 2,4-dibromo-1,5-dimethoxy-3-prop-2-enylbenzene.
| Compound Name | 2,4-dibromo-1,5-dimethoxy-3-prop-2-enylbenzene |
|---|---|
| PubChem CID | 46910681 |
| Molecular Formula | C11H12Br2O2 |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 2,4-dibromo-1,5-dimethoxy-3-prop-2-enylbenzene |
| SMILES | C=CCc1c(Br)c(OC)cc(OC)c1Br |
| InChI | InChI=1S/C11H12Br2O2/c1-4-5-7-10(12)8(14-2)6-9(15-3)11(7)13/h4,6H,1,5H2,2-3H3 |
| InChIKey | IUISCNDKGYFRCO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|