C13H20O2 — CID 143927430
1,2-dimethoxy-4-prop-2-enylbenzene;ethane (PubChem CID 143927430) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,2-dimethoxy-4-prop-2-enylbenzene;ethane.
| Compound Name | 1,2-dimethoxy-4-prop-2-enylbenzene;ethane |
|---|---|
| PubChem CID | 143927430 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1,2-dimethoxy-4-prop-2-enylbenzene;ethane |
| SMILES | C=CCc1ccc(OC)c(OC)c1.CC |
| InChI | InChI=1S/C11H14O2.C2H6/c1-4-5-9-6-7-10(12-2)11(8-9)13-3;1-2/h4,6-8H,1,5H2,2-3H3;1-2H3 |
| InChIKey | ODCYKZRRNIWMLI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|