About iron;(2-methoxy-4-prop-2-enylphenyl) formate
iron;(2-methoxy-4-prop-2-enylphenyl) formate (PubChem CID 174941140) has the molecular formula C11H12FeO3
and a molecular weight of 248.06 g/mol. Its IUPAC name is iron;(2-methoxy-4-prop-2-enylphenyl) formate.
Molecular Properties
| Compound Name | iron;(2-methoxy-4-prop-2-enylphenyl) formate |
| PubChem CID | 174941140 |
| Molecular Formula | C11H12FeO3 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | iron;(2-methoxy-4-prop-2-enylphenyl) formate |
| SMILES | C=CCc1ccc(OC=O)c(OC)c1.[Fe] |
| InChI | InChI=1S/C11H12O3.Fe/c1-3-4-9-5-6-10(14-8-12)11(7-9)13-2;/h3,5-8H,1,4H2,2H3; |
| InChIKey | CDZMKBQDPNLTQV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze iron;(2-methoxy-4-prop-2-enylphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;(2-methoxy-4-prop-2-enylphenyl) formate?
The IUPAC name of iron;(2-methoxy-4-prop-2-enylphenyl) formate (CID 174941140) is iron;(2-methoxy-4-prop-2-enylphenyl) formate.
What is the SMILES notation for iron;(2-methoxy-4-prop-2-enylphenyl) formate?
The canonical SMILES for iron;(2-methoxy-4-prop-2-enylphenyl) formate is C=CCc1ccc(OC=O)c(OC)c1.[Fe].
What is the InChIKey of iron;(2-methoxy-4-prop-2-enylphenyl) formate?
The InChIKey is CDZMKBQDPNLTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.Fe/c1-3-4-9-5-6-10(14-8-12)11(7-9)13-2;/h3,5-8H,1,4H2,2H3;.
What are the key properties of iron;(2-methoxy-4-prop-2-enylphenyl) formate?
iron;(2-methoxy-4-prop-2-enylphenyl) formate has a molecular weight of 248.06 g/mol, XLogP of 1.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;(2-methoxy-4-prop-2-enylphenyl) formate is sourced from PubChem (CID 174941140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).