C12H14O4 — CID 146301981
2-(2-methoxy-4-prop-2-enylphenoxy)ethene-1,1-diol (PubChem CID 146301981) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(2-methoxy-4-prop-2-enylphenoxy)ethene-1,1-diol.
| Compound Name | 2-(2-methoxy-4-prop-2-enylphenoxy)ethene-1,1-diol |
|---|---|
| PubChem CID | 146301981 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-(2-methoxy-4-prop-2-enylphenoxy)ethene-1,1-diol |
| SMILES | C=CCc1ccc(OC=C(O)O)c(OC)c1 |
| InChI | InChI=1S/C12H14O4/c1-3-4-9-5-6-10(11(7-9)15-2)16-8-12(13)14/h3,5-8,13-14H,1,4H2,2H3 |
| InChIKey | SZKVXWZKVHLCIG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|