C24H30O4 — CID 175132786
buta-1,3-diene;bis(2-methoxy-4-prop-2-enylphenol) (PubChem CID 175132786) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is buta-1,3-diene;bis(2-methoxy-4-prop-2-enylphenol).
| Compound Name | buta-1,3-diene;bis(2-methoxy-4-prop-2-enylphenol) |
|---|---|
| PubChem CID | 175132786 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | buta-1,3-diene;bis(2-methoxy-4-prop-2-enylphenol) |
| SMILES | C=CC=C.C=CCc1ccc(O)c(OC)c1.C=CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/2C10H12O2.C4H6/c2*1-3-4-8-5-6-9(11)10(7-8)12-2;1-3-4-2/h2*3,5-7,11H,1,4H2,2H3;3-4H,1-2H2 |
| InChIKey | PDAVESPGPATRJP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|