C13H20N2O2 — CID 174912037
2-methoxy-4-prop-2-enylphenol;propanimidamide (PubChem CID 174912037) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-methoxy-4-prop-2-enylphenol;propanimidamide.
| Compound Name | 2-methoxy-4-prop-2-enylphenol;propanimidamide |
|---|---|
| PubChem CID | 174912037 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol;propanimidamide |
| SMILES | C=CCc1ccc(O)c(OC)c1.[H]/N=C(/N)CC |
| InChI | InChI=1S/C10H12O2.C3H8N2/c1-3-4-8-5-6-9(11)10(7-8)12-2;1-2-3(4)5/h3,5-7,11H,1,4H2,2H3;2H2,1H3,(H3,4,5) |
| InChIKey | GIKBCCWPDYWDOI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|