About methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate
methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate (PubChem CID 137380786) has the molecular formula C23H32O5
and a molecular weight of 388.50 g/mol. Its IUPAC name is methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate.
Molecular Properties
| Compound Name | methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate |
| PubChem CID | 137380786 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate |
| SMILES | C=CCc1ccc(O)c(OC)c1.COC.Cc1ccc(OC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C11H14O2.C10H12O2.C2H6O/c1-8(2)11(12)13-10-6-4-9(3)5-7-10;1-3-4-8-5-6-9(11)10(7-8)12-2;1-3-2/h4-8H,1-3H3;3,5-7,11H,1,4H2,2H3;1-2H3 |
| InChIKey | LTVCQUGQSQDDSJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate?
The IUPAC name of methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate (CID 137380786) is methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate.
What is the SMILES notation for methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate?
The canonical SMILES for methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate is C=CCc1ccc(O)c(OC)c1.COC.Cc1ccc(OC(=O)C(C)C)cc1.
What is the InChIKey of methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate?
The InChIKey is LTVCQUGQSQDDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C10H12O2.C2H6O/c1-8(2)11(12)13-10-6-4-9(3)5-7-10;1-3-4-8-5-6-9(11)10(7-8)12-2;1-3-2/h4-8H,1-3H3;3,5-7,11H,1,4H2,2H3;1-2H3.
What are the key properties of methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate?
methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate has a molecular weight of 388.50 g/mol, XLogP of 4.95, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;2-methoxy-4-prop-2-enylphenol;(4-methylphenyl) 2-methylpropanoate is sourced from PubChem (CID 137380786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).