About (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate
(2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate (PubChem CID 93483199) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate.
Molecular Properties
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate |
| PubChem CID | 93483199 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate |
| SMILES | C=CCc1ccc(OC(=O)[C@H](C)CC)c(OC)c1 |
| InChI | InChI=1S/C15H20O3/c1-5-7-12-8-9-13(14(10-12)17-4)18-15(16)11(3)6-2/h5,8-11H,1,6-7H2,2-4H3/t11-/m1/s1 |
| InChIKey | SGAQPQHTGWRULN-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate?
The IUPAC name of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate (CID 93483199) is (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate.
What is the SMILES notation for (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate?
The canonical SMILES for (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate is C=CCc1ccc(OC(=O)[C@H](C)CC)c(OC)c1.
What is the InChIKey of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate?
The InChIKey is SGAQPQHTGWRULN-LLVKDONJSA-N. The full InChI is InChI=1S/C15H20O3/c1-5-7-12-8-9-13(14(10-12)17-4)18-15(16)11(3)6-2/h5,8-11H,1,6-7H2,2-4H3/t11-/m1/s1.
What are the key properties of (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate?
(2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate has a molecular weight of 248.32 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-prop-2-enylphenyl) (2R)-2-methylbutanoate is sourced from PubChem (CID 93483199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).