C25H24N2O4 — CID 53340645
(2-methoxy-4-prop-2-enylphenyl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate (PubChem CID 53340645) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate.
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 53340645 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) 3-phenyl-2-(pyridine-3-carbonylamino)propanoate |
| SMILES | C=CCc1ccc(OC(=O)C(Cc2ccccc2)NC(=O)c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C25H24N2O4/c1-3-8-18-12-13-22(23(16-18)30-2)31-25(29)21(15-19-9-5-4-6-10-19)27-24(28)20-11-7-14-26-17-20/h3-7,9-14,16-17,21H,1,8,15H2,2H3,(H,27,28) |
| InChIKey | SEOBFHXJYWQMQV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|