C31H31NO8 — CID 122605306
bis(2-methoxy-4-prop-2-enylphenyl) 3-(pyridine-3-carbonyloxy)pentanedioate (PubChem CID 122605306) has the molecular formula C31H31NO8 and a molecular weight of 545.59 g/mol. Its IUPAC name is bis(2-methoxy-4-prop-2-enylphenyl) 3-(pyridine-3-carbonyloxy)pentanedioate.
| Compound Name | bis(2-methoxy-4-prop-2-enylphenyl) 3-(pyridine-3-carbonyloxy)pentanedioate |
|---|---|
| PubChem CID | 122605306 |
| Molecular Formula | C31H31NO8 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | bis(2-methoxy-4-prop-2-enylphenyl) 3-(pyridine-3-carbonyloxy)pentanedioate |
| SMILES | C=CCc1ccc(OC(=O)CC(CC(=O)Oc2ccc(CC=C)cc2OC)OC(=O)c2cccnc2)c(OC)c1 |
| InChI | InChI=1S/C31H31NO8/c1-5-8-21-11-13-25(27(16-21)36-3)39-29(33)18-24(38-31(35)23-10-7-15-32-20-23)19-30(34)40-26-14-12-22(9-6-2)17-28(26)37-4/h5-7,10-17,20,24H,1-2,8-9,18-19H2,3-4H3 |
| InChIKey | ZZGWVHNNUHMBKK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|