C22H27NO7 — CID 123853703
[4-hydroxy-1-methoxy-4-[2-methoxy-4-(2-methylpropyl)phenoxy]-1-oxobutan-2-yl] pyridine-3-carboxylate (PubChem CID 123853703) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is [4-hydroxy-1-methoxy-4-[2-methoxy-4-(2-methylpropyl)phenoxy]-1-oxobutan-2-yl] pyridine-3-carboxylate.
| Compound Name | [4-hydroxy-1-methoxy-4-[2-methoxy-4-(2-methylpropyl)phenoxy]-1-oxobutan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 123853703 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [4-hydroxy-1-methoxy-4-[2-methoxy-4-(2-methylpropyl)phenoxy]-1-oxobutan-2-yl] pyridine-3-carboxylate |
| SMILES | COC(=O)C(CC(O)Oc1ccc(CC(C)C)cc1OC)OC(=O)c1cccnc1 |
| InChI | InChI=1S/C22H27NO7/c1-14(2)10-15-7-8-17(18(11-15)27-3)29-20(24)12-19(22(26)28-4)30-21(25)16-6-5-9-23-13-16/h5-9,11,13-14,19-20,24H,10,12H2,1-4H3 |
| InChIKey | PFLAVVQXEHZKGY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|