About ethane;5-methylhexan-3-yl pyridine-3-carboxylate
ethane;5-methylhexan-3-yl pyridine-3-carboxylate (PubChem CID 153333067) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is ethane;5-methylhexan-3-yl pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethane;5-methylhexan-3-yl pyridine-3-carboxylate |
| PubChem CID | 153333067 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | ethane;5-methylhexan-3-yl pyridine-3-carboxylate |
| SMILES | CC.CCC(CC(C)C)OC(=O)c1cccnc1 |
| InChI | InChI=1S/C13H19NO2.C2H6/c1-4-12(8-10(2)3)16-13(15)11-6-5-7-14-9-11;1-2/h5-7,9-10,12H,4,8H2,1-3H3;1-2H3 |
| InChIKey | LVBPCTWXOQVNKZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-methylhexan-3-yl pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylhexan-3-yl pyridine-3-carboxylate?
The IUPAC name of ethane;5-methylhexan-3-yl pyridine-3-carboxylate (CID 153333067) is ethane;5-methylhexan-3-yl pyridine-3-carboxylate.
What is the SMILES notation for ethane;5-methylhexan-3-yl pyridine-3-carboxylate?
The canonical SMILES for ethane;5-methylhexan-3-yl pyridine-3-carboxylate is CC.CCC(CC(C)C)OC(=O)c1cccnc1.
What is the InChIKey of ethane;5-methylhexan-3-yl pyridine-3-carboxylate?
The InChIKey is LVBPCTWXOQVNKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.C2H6/c1-4-12(8-10(2)3)16-13(15)11-6-5-7-14-9-11;1-2/h5-7,9-10,12H,4,8H2,1-3H3;1-2H3.
What are the key properties of ethane;5-methylhexan-3-yl pyridine-3-carboxylate?
ethane;5-methylhexan-3-yl pyridine-3-carboxylate has a molecular weight of 251.37 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylhexan-3-yl pyridine-3-carboxylate is sourced from PubChem (CID 153333067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).