C19H22N2O3 — CID 9414407
[(2R)-1-oxo-1-[[(2S)-2-phenylbutyl]amino]propan-2-yl] pyridine-3-carboxylate (PubChem CID 9414407) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[[(2S)-2-phenylbutyl]amino]propan-2-yl] pyridine-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-[[(2S)-2-phenylbutyl]amino]propan-2-yl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9414407 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(2R)-1-oxo-1-[[(2S)-2-phenylbutyl]amino]propan-2-yl] pyridine-3-carboxylate |
| SMILES | CC[C@H](CNC(=O)[C@@H](C)OC(=O)c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-15(16-8-5-4-6-9-16)13-21-18(22)14(2)24-19(23)17-10-7-11-20-12-17/h4-12,14-15H,3,13H2,1-2H3,(H,21,22)/t14-,15-/m1/s1 |
| InChIKey | PHHHYDNTJSIEPO-HUUCEWRRSA-N |
| XLogP | 2.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |