C20H23FN2O5S — CID 8506189
[(2S)-1-oxo-1-[[(2R)-2-phenylbutyl]amino]propan-2-yl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8506189) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(2R)-2-phenylbutyl]amino]propan-2-yl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [(2S)-1-oxo-1-[[(2R)-2-phenylbutyl]amino]propan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8506189 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [(2S)-1-oxo-1-[[(2R)-2-phenylbutyl]amino]propan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CC[C@@H](CNC(=O)[C@H](C)OC(=O)c1cc(S(N)(=O)=O)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C20H23FN2O5S/c1-3-14(15-7-5-4-6-8-15)12-23-19(24)13(2)28-20(25)17-11-16(29(22,26)27)9-10-18(17)21/h4-11,13-14H,3,12H2,1-2H3,(H,23,24)(H2,22,26,27)/t13-,14-/m0/s1 |
| InChIKey | CQIJPLYMVGLEFC-KBPBESRZSA-N |
| XLogP | 2.33 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |