C16H12Cl3FN2O5S — CID 46793128
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 46793128) has the molecular formula C16H12Cl3FN2O5S and a molecular weight of 469.71 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46793128 |
| Molecular Formula | C16H12Cl3FN2O5S |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 467.95 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CC(OC(=O)c1cc(S(N)(=O)=O)ccc1F)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3FN2O5S/c1-7(15(23)22-14-6-11(18)10(17)5-12(14)19)27-16(24)9-4-8(28(21,25)26)2-3-13(9)20/h2-7H,1H3,(H,22,23)(H2,21,25,26) |
| InChIKey | SIIQHZFIMMAKEC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|