C17H15Cl3N2O6S — CID 16518323
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16518323) has the molecular formula C17H15Cl3N2O6S and a molecular weight of 481.74 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16518323 |
| Molecular Formula | C17H15Cl3N2O6S |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)OC(C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl3N2O6S/c1-8(16(23)22-14-7-12(19)11(18)6-13(14)20)28-17(24)10-5-9(29(21,25)26)3-4-15(10)27-2/h3-8H,1-2H3,(H,22,23)(H2,21,25,26) |
| InChIKey | GKJYOJBQKNIJSJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|