C14H18N2O6S — CID 8985614
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate (PubChem CID 8985614) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8985614 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 2-methoxy-5-sulfamoylbenzoate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cc(S(N)(=O)=O)ccc1OC |
| InChI | InChI=1S/C14H18N2O6S/c1-4-7-16-13(17)9(2)22-14(18)11-8-10(23(15,19)20)5-6-12(11)21-3/h4-6,8-9H,1,7H2,2-3H3,(H,16,17)(H2,15,19,20)/t9-/m0/s1 |
| InChIKey | LCXFGTJTVPCDGN-VIFPVBQESA-N |
| XLogP | 0.19 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|