C16H13F3N2O5S — CID 8942944
[(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8942944) has the molecular formula C16H13F3N2O5S and a molecular weight of 402.35 g/mol. Its IUPAC name is [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8942944 |
| Molecular Formula | C16H13F3N2O5S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | [(2S)-1-(3,4-difluoroanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | C[C@H](OC(=O)c1cc(S(N)(=O)=O)ccc1F)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F3N2O5S/c1-8(15(22)21-9-2-4-13(18)14(19)6-9)26-16(23)11-7-10(27(20,24)25)3-5-12(11)17/h2-8H,1H3,(H,21,22)(H2,20,24,25)/t8-/m0/s1 |
| InChIKey | CFPHBDLJGFIKSQ-QMMMGPOBSA-N |
| XLogP | 1.94 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |