C18H19FN2O6S — CID 46625044
[1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 46625044) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 46625044 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [1-(2-ethoxyanilino)-1-oxopropan-2-yl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)C(C)OC(=O)c1cc(S(N)(=O)=O)ccc1F |
| InChI | InChI=1S/C18H19FN2O6S/c1-3-26-16-7-5-4-6-15(16)21-17(22)11(2)27-18(23)13-10-12(28(20,24)25)8-9-14(13)19/h4-11H,3H2,1-2H3,(H,21,22)(H2,20,24,25) |
| InChIKey | OSNVPNYWYRQTTI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |