C16H12Cl3NO4 — CID 3501692
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-hydroxybenzoate (PubChem CID 3501692) has the molecular formula C16H12Cl3NO4 and a molecular weight of 388.63 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-hydroxybenzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 3501692 |
| Molecular Formula | C16H12Cl3NO4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 2-hydroxybenzoate |
| SMILES | CC(OC(=O)c1ccccc1O)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO4/c1-8(24-16(23)9-4-2-3-5-14(9)21)15(22)20-13-7-11(18)10(17)6-12(13)19/h2-8,21H,1H3,(H,20,22) |
| InChIKey | KGCMWXNQCXPFCF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|