C16H12F3NO4 — CID 7484915
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-hydroxybenzoate (PubChem CID 7484915) has the molecular formula C16H12F3NO4 and a molecular weight of 339.27 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-hydroxybenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 7484915 |
| Molecular Formula | C16H12F3NO4 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-hydroxybenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1O)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3NO4/c1-8(24-16(23)9-4-2-3-5-12(9)21)15(22)20-11-7-6-10(17)13(18)14(11)19/h2-8,21H,1H3,(H,20,22)/t8-/m1/s1 |
| InChIKey | OMDWNBFUCWKSNG-MRVPVSSYSA-N |
| XLogP | 2.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|