C18H16F3NO3S — CID 8658611
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethylsulfanylbenzoate (PubChem CID 8658611) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethylsulfanylbenzoate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658611 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O[C@@H](C)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H16F3NO3S/c1-3-26-14-7-5-4-6-11(14)18(24)25-10(2)17(23)22-13-9-8-12(19)15(20)16(13)21/h4-10H,3H2,1-2H3,(H,22,23)/t10-/m0/s1 |
| InChIKey | AHTQQFWLFWVXLM-JTQLQIEISA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|