C15H19NO3S — CID 8658606
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate (PubChem CID 8658606) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658606 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O[C@@H](C)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H19NO3S/c1-3-20-13-7-5-4-6-12(13)15(18)19-10(2)14(17)16-11-8-9-11/h4-7,10-11H,3,8-9H2,1-2H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | YWKADABORXQSIH-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |