C18H24N2O4S — CID 8959484
[(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate (PubChem CID 8959484) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate.
| Compound Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8959484 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)O[C@H](C)C(=O)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H24N2O4S/c1-3-25-15-11-7-6-10-14(15)17(22)24-12(2)16(21)20-18(23)19-13-8-4-5-9-13/h6-7,10-13H,3-5,8-9H2,1-2H3,(H2,19,20,21,23)/t12-/m1/s1 |
| InChIKey | PONDBOPCMYYOHD-GFCCVEGCSA-N |
| XLogP | 3.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |