C14H17NO3S — CID 8658293
[2-(cyclopropylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate (PubChem CID 8658293) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
|---|---|
| PubChem CID | 8658293 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-ethylsulfanylbenzoate |
| SMILES | CCSc1ccccc1C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C14H17NO3S/c1-2-19-12-6-4-3-5-11(12)14(17)18-9-13(16)15-10-7-8-10/h3-6,10H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | XEBZZLSVFKEGII-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |