C13H15NO5S — CID 7725286
[2-(cyclopropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 7725286) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725286 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)OCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H15NO5S/c1-20(17,18)11-5-3-2-4-10(11)13(16)19-8-12(15)14-9-6-7-9/h2-5,9H,6-8H2,1H3,(H,14,15) |
| InChIKey | CXMPELNVPBEBQU-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |