C14H19NO5S — CID 18080442
[2-(2-methylpropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 18080442) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is [2-(2-methylpropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18080442 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-(2-methylpropylamino)-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CC(C)CNC(=O)COC(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C14H19NO5S/c1-10(2)8-15-13(16)9-20-14(17)11-6-4-5-7-12(11)21(3,18)19/h4-7,10H,8-9H2,1-3H3,(H,15,16) |
| InChIKey | WUMZYMLNFXXWRK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |