C22H27NO5S — CID 7725530
[2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate (PubChem CID 7725530) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate.
| Compound Name | [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725530 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-[[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] 2-methylsulfonylbenzoate |
| SMILES | CC(C)Cc1ccc([C@H](C)NC(=O)COC(=O)c2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-15(2)13-17-9-11-18(12-10-17)16(3)23-21(24)14-28-22(25)19-7-5-6-8-20(19)29(4,26)27/h5-12,15-16H,13-14H2,1-4H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | MNHSNORYMNRYDV-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |