C24H26N2O3 — CID 7813099
[2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 7813099) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7813099 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | [2-[[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]amino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | CC(C)Cc1ccc([C@@H](C)NC(=O)COC(=O)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H26N2O3/c1-16(2)14-18-8-10-19(11-9-18)17(3)25-23(27)15-29-24(28)22-13-12-20-6-4-5-7-21(20)26-22/h4-13,16-17H,14-15H2,1-3H3,(H,25,27)/t17-/m1/s1 |
| InChIKey | BMBYTFFKMCBJMY-QGZVFWFLSA-N |
| XLogP | 4.47 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |