C22H22N2O3 — CID 16540465
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] quinoline-2-carboxylate (PubChem CID 16540465) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] quinoline-2-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 16540465 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] quinoline-2-carboxylate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H22N2O3/c1-16(11-12-17-7-3-2-4-8-17)23-21(25)15-27-22(26)20-14-13-18-9-5-6-10-19(18)24-20/h2-10,13-14,16H,11-12,15H2,1H3,(H,23,25) |
| InChIKey | PYPAUTJRTCPHFD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |