About [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate (PubChem CID 3996616) has the molecular formula C27H25NO3
and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate |
| PubChem CID | 3996616 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C27H25NO3/c1-19(15-16-20-9-3-2-4-10-20)28-25(29)18-31-27(30)26-23-13-7-5-11-21(23)17-22-12-6-8-14-24(22)26/h2-14,17,19H,15-16,18H2,1H3,(H,28,29) |
| InChIKey | CHCUHZNAABIBMV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate?
The IUPAC name of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate (CID 3996616) is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate.
What is the SMILES notation for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate?
The canonical SMILES for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate is CC(CCc1ccccc1)NC(=O)COC(=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate?
The InChIKey is CHCUHZNAABIBMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO3/c1-19(15-16-20-9-3-2-4-10-20)28-25(29)18-31-27(30)26-23-13-7-5-11-21(23)17-22-12-6-8-14-24(22)26/h2-14,17,19H,15-16,18H2,1H3,(H,28,29).
What are the key properties of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate?
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate has a molecular weight of 411.50 g/mol, XLogP of 5.29, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate is sourced from PubChem (CID 3996616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).