C27H25NO3 — CID 3996616
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate (PubChem CID 3996616) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 3996616 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] anthracene-9-carboxylate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C27H25NO3/c1-19(15-16-20-9-3-2-4-10-20)28-25(29)18-31-27(30)26-23-13-7-5-11-21(23)17-22-12-6-8-14-24(22)26/h2-14,17,19H,15-16,18H2,1H3,(H,28,29) |
| InChIKey | CHCUHZNAABIBMV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|