C22H23NO3 — CID 2630406
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] anthracene-9-carboxylate (PubChem CID 2630406) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] anthracene-9-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 2630406 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] anthracene-9-carboxylate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C22H23NO3/c1-3-8-15(2)23-20(24)14-26-22(25)21-18-11-6-4-9-16(18)13-17-10-5-7-12-19(17)21/h4-7,9-13,15H,3,8,14H2,1-2H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | DEDPDQNUIOQXOO-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|