C16H20N2O3 — CID 18081770
[2-oxo-2-(pentan-2-ylamino)ethyl] 1H-indole-2-carboxylate (PubChem CID 18081770) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 18081770 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 1H-indole-2-carboxylate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-6-11(2)17-15(19)10-21-16(20)14-9-12-7-4-5-8-13(12)18-14/h4-5,7-9,11,18H,3,6,10H2,1-2H3,(H,17,19) |
| InChIKey | UKYNMNXEJUIPEJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |