C20H20N2O3 — CID 42918412
[2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 42918412) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 42918412 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | CC(c1ccccc1)N(C)C(=O)COC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H20N2O3/c1-14(15-8-4-3-5-9-15)22(2)19(23)13-25-20(24)18-12-16-10-6-7-11-17(16)21-18/h3-12,14,21H,13H2,1-2H3 |
| InChIKey | YUBOVEDLUPHZIK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |