C20H23NO4S — CID 55374904
[2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 2-ethylsulfinylbenzoate (PubChem CID 55374904) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 2-ethylsulfinylbenzoate.
| Compound Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 55374904 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-[methyl(1-phenylethyl)amino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCC(=O)N(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c1-4-26(24)18-13-9-8-12-17(18)20(23)25-14-19(22)21(3)15(2)16-10-6-5-7-11-16/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | LZYQGYNAMAHKNN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |