C22H23N3O4 — CID 7723665
[2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7723665) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7723665 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-[[2-(2-ethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)COC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H23N3O4/c1-3-15-8-4-6-10-17(15)24-20(26)13-25(2)21(27)14-29-22(28)19-12-16-9-5-7-11-18(16)23-19/h4-12,23H,3,13-14H2,1-2H3,(H,24,26) |
| InChIKey | KDUALOFLWKGGGE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |